Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
E468707-100mg
|
100mg |
2
|
$91.90
|
|
|
E468707-250mg
|
250mg |
2
|
$161.90
|
|
| Synonyms | 2-nitro-1-(oxiran-2-ylmethyl)imidazole | SYFMSLVOHQZYEB-UHFFFAOYSA-N | SCHEMBL1614716 | NSC342688 | NSC-342688 | 1-(2,3-Epoxypropyl)-2-nitroimidazole, 97% | 1-(2,3-Epoxypropyl)-2-nitroimidazole | 2-nitro-1-(oxiran-2-ylmethyl)-1H-imidazole | DTXSID60319241 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic 1,3-dipolar compounds |
| Class | Allyl-type 1,3-dipolar organic compounds |
| Subclass | Organic nitro compounds |
| Intermediate Tree Nodes | C-nitro compounds |
| Direct Parent | Nitroaromatic compounds |
| Alternative Parents | N-substituted imidazoles Heteroaromatic compounds Propargyl-type 1,3-dipolar organic compounds Oxacyclic compounds Organic oxoazanium compounds Epoxides Dialkyl ethers Azacyclic compounds Organonitrogen compounds Organic salts Organic oxides Hydrocarbon derivatives Organic cations |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Nitroaromatic compound - N-substituted imidazole - Azole - Imidazole - Heteroaromatic compound - Dialkyl ether - Oxacycle - Azacycle - Organoheterocyclic compound - Oxirane - Propargyl-type 1,3-dipolar organic compound - Ether - Organic oxoazanium - Organic oxygen compound - Organic oxide - Organonitrogen compound - Organooxygen compound - Organic nitrogen compound - Organic salt - Hydrocarbon derivative - Organic cation - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as nitroaromatic compounds. These are c-nitro compounds where the nitro group is C-substituted with an aromatic group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-nitro-1-(oxiran-2-ylmethyl)imidazole |
|---|---|
| INCHI | InChI=1S/C6H7N3O3/c10-9(11)6-7-1-2-8(6)3-5-4-12-5/h1-2,5H,3-4H2 |
| InChIKey | SYFMSLVOHQZYEB-UHFFFAOYSA-N |
| Smiles | C1C(O1)CN2C=CN=C2[N+](=O)[O-] |
| Isomeric SMILES | C1C(O1)CN2C=CN=C2[N+](=O)[O-] |
| Molecular Weight | 169.14 |
| Reaxy-Rn | 612095 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=612095&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jan 29, 2024 | E468707 | |
| Certificate of Analysis | Jan 29, 2024 | E468707 | |
| Certificate of Analysis | Jan 29, 2024 | E468707 | |
| Certificate of Analysis | Jan 29, 2024 | E468707 |
| Flash Point(°F) | Not applicable |
|---|---|
| Flash Point(°C) | Not applicable |
| Melt Point(°C) | 50-55℃ |
| Molecular Weight | 169.140 g/mol |
| XLogP3 | -0.100 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 2 |
| Exact Mass | 169.049 Da |
| Monoisotopic Mass | 169.049 Da |
| Topological Polar Surface Area | 76.200 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 193.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |