Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D178605-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$584.90
|
|
Discover 1,1-diethyl 3-oxocyclobutane-1,1-dicarboxylate by Aladdin Scientific in 97% for only $584.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 1,1-Diethyl 3-oxocyclobutane-1,1-dicarboxylate | 99173-61-2 | diethyl 3-oxocyclobutane-1,1-dicarboxylate | 1,1-Cyclobutanedicarboxylic acid, 3-oxo-, diethyl ester | MFCD20928423 | SCHEMBL3147434 | DTXSID10563393 | RNEYQVYRVAVAIF-UHFFFAOYSA-N | ZDA17361 | AKOS010209398 | SB11 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Dicarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Dicarboxylic acids and derivatives |
| Alternative Parents | Cyclic ketones Carboxylic acid esters Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Dicarboxylic acid or derivatives - Cyclic ketone - Ketone - Carboxylic acid ester - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as dicarboxylic acids and derivatives. These are organic compounds containing exactly two carboxylic acid groups. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | diethyl 3-oxocyclobutane-1,1-dicarboxylate |
|---|---|
| INCHI | InChI=1S/C10H14O5/c1-3-14-8(12)10(5-7(11)6-10)9(13)15-4-2/h3-6H2,1-2H3 |
| InChIKey | RNEYQVYRVAVAIF-UHFFFAOYSA-N |
| Smiles | CCOC(=O)C1(CC(=O)C1)C(=O)OCC |
| Isomeric SMILES | CCOC(=O)C1(CC(=O)C1)C(=O)OCC |
| Molecular Weight | 214.217 |
| Reaxy-Rn | 3305896 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3305896&ln= |
| Molecular Weight | 214.210 g/mol |
|---|---|
| XLogP3 | 0.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 6 |
| Exact Mass | 214.084 Da |
| Monoisotopic Mass | 214.084 Da |
| Topological Polar Surface Area | 69.700 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 266.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |